CAS 518357-40-9 appears in our catalog under these names: C-(4'-Fluoro-biphenyl-4-yl)-methylamine hydrochloride, 95%, (4–(4–Fluorophenyl)phenyl)methylamine hydrochloride, (4'-Fluoro-[1,1'-biphenyl]-4-yl)methanamine hydrochloride, 95%, 95%, (4'-Fluoro-[1,1'-biphenyl]-4-yl)methanaminehydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
[4-(4-fluorophenyl)phenyl]methanamine;hydrochloride (CAS 518357-40-9) is a chemical compound with the molecular formula C13H13ClFN and a molecular weight of 237.70 g/mol. IUPAC name: [4-(4-fluorophenyl)phenyl]methanamine;hydrochloride. InChIKey: IZUWYHXAARRMGW-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFN |
|---|---|
| Molecular weight | 237.70 g/mol |
| IUPAC name | [4-(4-fluorophenyl)phenyl]methanamine;hydrochloride |
| InChIKey | IZUWYHXAARRMGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)