cas: 1311159-05-3 — see every product listed under this CAS number, including other names
[5-Methyl-2-(2,2,2-trifluoroethoxy)phenyl]boranediol, 97%, 97% (CAS 1311159-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13A4AM-100mg |
| cas | 1311159-05-3 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 530.00 Pln | |
| Chemat | 250mg | 904.40 Pln | |
| Chemat | 1g | 2109.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid (CAS 1311159-05-3) is a chemical compound with the molecular formula C9H10BF3O3 and a molecular weight of 233.98 g/mol. IUPAC name: [5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid. InChIKey: NISGGCJCHFHXGN-UHFFFAOYSA-N.
| Molecular formula | C9H10BF3O3 |
|---|---|
| Molecular weight | 233.98 g/mol |
| IUPAC name | [5-methyl-2-(2,2,2-trifluoroethoxy)phenyl]boronic acid |
| InChIKey | NISGGCJCHFHXGN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)OCC(F)(F)F)(O)O |
Computed by PubChem (NCBI)