cas: 360-03-2 — see every product listed under this CAS number, including other names
α,α-Difluorobenzeneacetic acid 98% (CAS 360-03-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656309-1g |
| cas | 360-03-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 25g | 1366.06 Pln | |
| Ambeed | 100g | 2934.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A656309 |
2,2-difluoro-2-phenylacetic acid (CAS 360-03-2) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,2-difluoro-2-phenylacetic acid. InChIKey: PFKSLFZFBCIJOI-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,2-difluoro-2-phenylacetic acid |
| InChIKey | PFKSLFZFBCIJOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)