Products 360-03-2
CAS 360-03-2 appears in our catalog under these names: 2,2-Difluoro-2-phenylacetic acid, 97%, 2,2-Difluoro-2-phenylacetic Acid, >95% (HPLC), 2,2-difluoro-2-phenylacetic acid, 97%, 97%, alpha,alpha-Difluorophenylacetic acid, 97% , α,α-Difluorobenzeneacetic acid 98%. Offered by: Combi-blocks, TRC, Chemat, Thermo Scientific (Alfa Aesar), Ambeed. Available pack sizes: 25g, 1g, 100g, 5g, 100mg, 250mg, 500mg.
2,2-difluoro-2-phenylacetic acid (CAS 360-03-2) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,2-difluoro-2-phenylacetic acid. InChIKey: PFKSLFZFBCIJOI-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,2-difluoro-2-phenylacetic acid |
| InChIKey | PFKSLFZFBCIJOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2,2-difluoro-2-phenylacetic acid, difluoro(phenyl)acetic acid, alpha,alpha-difluorophenylacetic acid, A,A-Difluorophenylacetic acid, alpha,alpha-difluorobenzeneacetic acid, Benzeneacetic acid, a,a-difluoro-, 2,2-difluoro-2-phenyl-acetic acid, Maybridge1_002109, ,-Difluorobenzeneacetic acid, |A,|A-Difluorophenylacetic acid