Products 112857-68-8

CAS 112857-68-8 appears in our catalog under these names: 2,4-Difluoro-3-methylbenzoic acid, 95%, 2,4-difluoro-3-methylbenzoic Acid, 2,4-Difluoro-3-methylbenzoic acid, ≥95%. Offered by: Combi-blocks, Biosynth, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,4-difluoro-3-methylbenzoic acid (CAS 112857-68-8) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,4-difluoro-3-methylbenzoic acid. InChIKey: OCJDCFUHHBCTFI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O2
Molecular weight172.13 g/mol
IUPAC name2,4-difluoro-3-methylbenzoic acid
InChIKeyOCJDCFUHHBCTFI-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1F)C(=O)O)F

Computed by PubChem (NCBI)