CAS 133186-55-7 is the registry number for 3',5'-Difluoro-4'-hydroxyacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(3,5-difluoro-4-hydroxyphenyl)ethanone (CAS 133186-55-7) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 1-(3,5-difluoro-4-hydroxyphenyl)ethanone. InChIKey: QPXWOHYRUCULSO-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 1-(3,5-difluoro-4-hydroxyphenyl)ethanone |
| InChIKey | QPXWOHYRUCULSO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C(=C1)F)O)F |
Computed by PubChem (NCBI)