Products 32890-88-3
CAS 32890-88-3 appears in our catalog under these names: 2,6–Difluoro–3–methylbenzoic acid, 2,6-Difluoro-3-methylbenzoic acid, 2,6-Difluoro-3-methylbenzoic acid, 98%, 2,6-Difluoro-3-methylbenzoic acid 98%, 2,6-difluoro-3-methylbenzoic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
2,6-difluoro-3-methylbenzoic acid (CAS 32890-88-3) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,6-difluoro-3-methylbenzoic acid. InChIKey: QZIVNVIPFGKDQE-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,6-difluoro-3-methylbenzoic acid |
| InChIKey | QZIVNVIPFGKDQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C(=O)O)F |
Computed by PubChem (NCBI)