Products 1003709-96-3
CAS 1003709-96-3 appears in our catalog under these names: 2,3-Difluoro-5-methylbenzoic acid, 95%, 2,3-Difluoro-5-methylbenzoic acid, 98%, 2,3-Difluoro-5-methylbenzoic acid, 2,3-Difluoro-5-methylbenzoic acid 97%, 2,3-Difluoro-5-methylbenzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 500mg, 1000mg, 100mg.
2,3-difluoro-5-methylbenzoic acid (CAS 1003709-96-3) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,3-difluoro-5-methylbenzoic acid. InChIKey: PJDCKKOTZDVVOV-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,3-difluoro-5-methylbenzoic acid |
| InChIKey | PJDCKKOTZDVVOV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)