Products 1003709-96-3

CAS 1003709-96-3 appears in our catalog under these names: 2,3-Difluoro-5-methylbenzoic acid, 95%, 2,3-Difluoro-5-methylbenzoic acid, 98%, 2,3-Difluoro-5-methylbenzoic acid, 2,3-Difluoro-5-methylbenzoic acid, 97%, 97%, 2,3-Difluoro-5-methylbenzoic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 500mg, 1000mg, 100mg.

Structural formula: {0} (CAS {1})

2,3-difluoro-5-methylbenzoic acid (CAS 1003709-96-3) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,3-difluoro-5-methylbenzoic acid. InChIKey: PJDCKKOTZDVVOV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O2
Molecular weight172.13 g/mol
IUPAC name2,3-difluoro-5-methylbenzoic acid
InChIKeyPJDCKKOTZDVVOV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)F)F)C(=O)O

Computed by PubChem (NCBI)