Products 103877-80-1

CAS 103877-80-1 appears in our catalog under these names: 2,5-Difluoro-4-methylbenzoic acid, 98%, 2,5–Difluoro–4–methylbenzoic acid, 2,5-Difluoro-4-methylbenzoic acid, 96%, 2,5-Difluoro-4-methylbenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2,5-difluoro-4-methylbenzoic acid (CAS 103877-80-1) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,5-difluoro-4-methylbenzoic acid. InChIKey: PWWMQUUDAAWEBK-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F2O2
Molecular weight172.13 g/mol
IUPAC name2,5-difluoro-4-methylbenzoic acid
InChIKeyPWWMQUUDAAWEBK-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1F)C(=O)O)F

Computed by PubChem (NCBI)