1,1'-Biisoquinoline, 97%
cas: 17999-93-8 — see every product listed under this CAS number, including other names
1,1'-Biisoquinoline, 97% (CAS 17999-93-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F544801-1G |
| cas | 17999-93-8 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 6698.70 Pln | |
| Ambeed | 100mg | 793.12 Pln | |
| Ambeed | 250mg | 1516.25 Pln | |
| Ambeed | 1g | 4419.88 Pln | |
| Ambeed | 5g | 8769.75 Pln | |
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 1139.60 Pln | |
| Chemat | 5g | 9462.80 Pln | |
| BLDpharm | 100mg | 853.06 Pln | |
| BLDpharm | 250mg | 1625.01 Pln | |
| BLDpharm | 1g | 4762.79 Pln | |
| BLDpharm | 5g | 9450.03 Pln | |
| Fluorochem | 100mg | 1148.57 Pln | |
| Fluorochem | 250mg | 2111.77 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-isoquinolin-1-ylisoquinoline (CAS 17999-93-8) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 1-isoquinolin-1-ylisoquinoline. InChIKey: MVVRNAUFPUDQIB-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 1-isoquinolin-1-ylisoquinoline |
| InChIKey | MVVRNAUFPUDQIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2C3=NC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)