CAS 62806-30-8 is the registry number for 2,2'-(Anthracene-9,10-diyl)diacetonitrile, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[10-(cyanomethyl)anthracen-9-yl]acetonitrile (CAS 62806-30-8) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 2-[10-(cyanomethyl)anthracen-9-yl]acetonitrile. InChIKey: DVOPOFKLZRECLO-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 2-[10-(cyanomethyl)anthracen-9-yl]acetonitrile |
| InChIKey | DVOPOFKLZRECLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=C2CC#N)CC#N |
Computed by PubChem (NCBI)