CAS 109559-47-9 appears in our catalog under these names: 2-Phenyl-1,10-phenanthroline 97%, 2-Phenyl-1,10-phenanthroline, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
2-phenyl-1,10-phenanthroline (CAS 109559-47-9) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 2-phenyl-1,10-phenanthroline. InChIKey: IYKBMPHOPLFHAQ-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 2-phenyl-1,10-phenanthroline |
| InChIKey | IYKBMPHOPLFHAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC4=C3N=CC=C4)C=C2 |
Computed by PubChem (NCBI)