CAS 119-91-5 appears in our catalog under these names: 2,2'-Biquinoline, 98% , 2,2'-Biquinoline, 2,2'-Biquinoline, 98%, 2,2'-Biquinoline, >98.0%(HPLC)(T), 2,2'-Biquinoline 98%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 50g, 10g, 100g, 500g.
2-quinolin-2-ylquinoline (CAS 119-91-5) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 2-quinolin-2-ylquinoline. InChIKey: WPTCSQBWLUUYDV-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 2-quinolin-2-ylquinoline |
| InChIKey | WPTCSQBWLUUYDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=NC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)