CAS 612-79-3 appears in our catalog under these names: 6,6'-Biquinoline, 95%, 6,6'-Biquinoline 95%, 6,6'-biquinoline, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
6-quinolin-6-ylquinoline (CAS 612-79-3) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 6-quinolin-6-ylquinoline. InChIKey: CCKFFRXAFQLLDF-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 6-quinolin-6-ylquinoline |
| InChIKey | CCKFFRXAFQLLDF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=CC4=C(C=C3)N=CC=C4)N=C1 |
Computed by PubChem (NCBI)