CAS 120090-61-1 is the registry number for 9-(Pyridin-4-yl)acridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
9-pyridin-4-ylacridine (CAS 120090-61-1) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 9-pyridin-4-ylacridine. InChIKey: SQTMATWWLLQKTQ-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 9-pyridin-4-ylacridine |
| InChIKey | SQTMATWWLLQKTQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)C4=CC=NC=C4 |
Computed by PubChem (NCBI)