Products 200339-30-6
CAS 200339-30-6 appears in our catalog under these names: 5,8-Dihydroindolo[2,3-c]carbazole 97%, 5,8-Dihydroindolo[2,3-c]carbazole, 98%, 98%, 5,8-DIHYDROINDOLO[2,3-C]CARBAZOLE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 250mg, 1g, 5g, 25g, 100mg, 50g.
9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (CAS 200339-30-6) is a chemical compound with the molecular formula C18H12N2 and a molecular weight of 256.3 g/mol. IUPAC name: 9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene. InChIKey: QXLFTMGRUGFOAB-UHFFFAOYSA-N.
| Molecular formula | C18H12N2 |
|---|---|
| Molecular weight | 256.3 g/mol |
| IUPAC name | 9,14-diazapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| InChIKey | QXLFTMGRUGFOAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=CC4=C3C5=CC=CC=C5N4 |
Computed by PubChem (NCBI)