cas: 102368-13-8 — see every product listed under this CAS number, including other names
1,1'-Thiocarbonylbis(pyridin-2(1H)-one), 99%, 99% (CAS 102368-13-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1118AH-1kg |
| cas | 102368-13-8 |
| size | 1kg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 2829.20 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 146.00 Pln | |
| Chemat | 25g | 256.40 Pln | |
| Chemat | 50g | 405.20 Pln | |
| Chemat | 100g | 683.60 Pln | |
| Chemat | 250g | 1235.60 Pln | |
| Chemat | 500g | 2404.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
1-(2-oxopyridine-1-carbothioyl)pyridin-2-one (CAS 102368-13-8) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: 1-(2-oxopyridine-1-carbothioyl)pyridin-2-one. InChIKey: KXMMNJQMGILZDB-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 1-(2-oxopyridine-1-carbothioyl)pyridin-2-one |
| InChIKey | KXMMNJQMGILZDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C=C1)C(=S)N2C=CC=CC2=O |
Computed by PubChem (NCBI)