CAS 88683-57-2 appears in our catalog under these names: 3-((1,3-Dioxoisoindolin-2-yl)thio)propanenitrile 95%, 3-[(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)sulfanyl]propanenitrile, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-(1,3-dioxoisoindol-2-yl)sulfanylpropanenitrile (CAS 88683-57-2) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)sulfanylpropanenitrile. InChIKey: MVZDBGUIRMGSOY-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)sulfanylpropanenitrile |
| InChIKey | MVZDBGUIRMGSOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)SCCC#N |
Computed by PubChem (NCBI)