CAS 32329-52-5 appears in our catalog under these names: WAY–325046, 8-Methoxy-2H-benzo[4,5]thiazolo[3,2-a]pyrimidin-2-one, ≥95%, ≥95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 5mg.
8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one (CAS 32329-52-5) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one. InChIKey: HHQZVPAQTWLWON-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one |
| InChIKey | HHQZVPAQTWLWON-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N3C=CC(=O)N=C3S2 |
Computed by PubChem (NCBI)