CAS 181283-29-4 is the registry number for Methyl 3-amino-7-cyano-1-benzothiophene-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3-amino-7-cyano-1-benzothiophene-2-carboxylate (CAS 181283-29-4) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: methyl 3-amino-7-cyano-1-benzothiophene-2-carboxylate. InChIKey: POMQECNHCVEEKJ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | methyl 3-amino-7-cyano-1-benzothiophene-2-carboxylate |
| InChIKey | POMQECNHCVEEKJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC(=C2S1)C#N)N |
Computed by PubChem (NCBI)