CAS 96989-50-3 appears in our catalog under these names: Di-2-pyridyl thionocarbonate, 95%, Di-2-pyridyl thionocarbonate, 98% , O,O'-Di-2-pyridyl Thiocarbonate, >98.0%(N), Di-2-pyridyl thionocarbonate, 97%, DI-2-PYRIDYL THIONOCARBONATE, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 250mg, 10g, 15g, 100g.
Dipyridin-2-yloxymethanethione (CAS 96989-50-3) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: dipyridin-2-yloxymethanethione. InChIKey: IKYOVSVBLHGFMA-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | dipyridin-2-yloxymethanethione |
| InChIKey | IKYOVSVBLHGFMA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)OC(=S)OC2=CC=CC=N2 |
Computed by PubChem (NCBI)