CAS 1082134-24-4 is the registry number for 5-(2-Furyl)-2-methylthieno[2,3-d]pyrimidin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(furan-2-yl)-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1082134-24-4) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: 5-(furan-2-yl)-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: UDHBCVMVWIIEKJ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2S |
|---|---|
| Molecular weight | 232.26 g/mol |
| IUPAC name | 5-(furan-2-yl)-2-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | UDHBCVMVWIIEKJ-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=CS2)C3=CC=CO3)C(=O)N1 |
Computed by PubChem (NCBI)