Products 74002-60-1

CAS 74002-60-1 appears in our catalog under these names: 3-(Phenylsulfanyl)pyrazine-2-carboxylic acid, 95%, 3-(Phenylsulfanyl)pyrazine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-phenylsulfanylpyrazine-2-carboxylic acid (CAS 74002-60-1) is a chemical compound with the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. IUPAC name: 3-phenylsulfanylpyrazine-2-carboxylic acid. InChIKey: KLNMOOQFTYGDPO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8N2O2S
Molecular weight232.26 g/mol
IUPAC name3-phenylsulfanylpyrazine-2-carboxylic acid
InChIKeyKLNMOOQFTYGDPO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)SC2=NC=CN=C2C(=O)O

Computed by PubChem (NCBI)