1,1'-Thiocarbonyldiimidazole, 98%, 98%
cas: 6160-65-2 — see every product listed under this CAS number, including other names
1,1'-Thiocarbonyldiimidazole, 98%, 98% (CAS 6160-65-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143JV-1g |
| cas | 6160-65-2 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 50g | 232.40 Pln | |
| Chemat | 100g | 390.80 Pln | |
| Chemat | 250g | 832.40 Pln | |
| Chemat | 500g | 1612.80 Pln | |
| Chemat | 1kg | 3078.80 Pln | |
| Chemat | 5kg | 8956.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Di(imidazol-1-yl)methanethione (CAS 6160-65-2) is a chemical compound with the molecular formula C7H6N4S and a molecular weight of 178.22 g/mol. IUPAC name: di(imidazol-1-yl)methanethione. InChIKey: RAFNCPHFRHZCPS-UHFFFAOYSA-N.
| Molecular formula | C7H6N4S |
|---|---|
| Molecular weight | 178.22 g/mol |
| IUPAC name | di(imidazol-1-yl)methanethione |
| InChIKey | RAFNCPHFRHZCPS-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C(=S)N2C=CN=C2 |
Computed by PubChem (NCBI)