cas: 461-92-7 — see every product listed under this CAS number, including other names
1,1,1-Trifluoro-6-methylheptan-2,4-dione, 99+%, 99+% (CAS 461-92-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DD7T-250mg |
| cas | 461-92-7 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 530.00 Pln |
| purity | 99+% |
|---|---|
| delivery time | 3 weeks |
1,1,1-trifluoro-6-methylheptane-2,4-dione (CAS 461-92-7) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1,1,1-trifluoro-6-methylheptane-2,4-dione. InChIKey: XWBVTGFPQXBNOZ-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-6-methylheptane-2,4-dione |
| InChIKey | XWBVTGFPQXBNOZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)