cas: 461-92-7 — see every product listed under this CAS number, including other names
1,1,1-trifluoro-2-hydroxy-6-methylhept-2-en-4-one, 98% (CAS 461-92-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F638326-1G |
| cas | 461-92-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 497.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,1,1-trifluoro-6-methylheptane-2,4-dione (CAS 461-92-7) is a chemical compound with the molecular formula C8H11F3O2 and a molecular weight of 196.17 g/mol. IUPAC name: 1,1,1-trifluoro-6-methylheptane-2,4-dione. InChIKey: XWBVTGFPQXBNOZ-UHFFFAOYSA-N.
| Molecular formula | C8H11F3O2 |
|---|---|
| Molecular weight | 196.17 g/mol |
| IUPAC name | 1,1,1-trifluoro-6-methylheptane-2,4-dione |
| InChIKey | XWBVTGFPQXBNOZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)