cas: 4355-11-7 — see every product listed under this CAS number, including other names
1,1-Cyclohexanediaceticacid, 97%, 97% (CAS 4355-11-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1kg, 10g, 25g, 100g, 300g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114D8Z-5g |
| cas | 4355-11-7 |
| size | 5g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 69.20 Pln | |
| Chemat | 1kg | 333.20 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 74.00 Pln | |
| Chemat | 100g | 78.80 Pln | |
| Chemat | 300g | 126.80 Pln | |
| Chemat | 500g | 206.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-[1-(carboxymethyl)cyclohexyl]acetic acid (CAS 4355-11-7) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 2-[1-(carboxymethyl)cyclohexyl]acetic acid. InChIKey: YQPCHPBGAALCRT-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-[1-(carboxymethyl)cyclohexyl]acetic acid |
| InChIKey | YQPCHPBGAALCRT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)