Products 2308512-34-5

CAS 2308512-34-5 is the registry number for 2-(Oxan-4-yl)-3-oxopropanoic acid ethyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl (Z)-3-hydroxy-2-(oxan-4-yl)prop-2-enoate (CAS 2308512-34-5) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl (Z)-3-hydroxy-2-(oxan-4-yl)prop-2-enoate. InChIKey: HNSRSWSQYMAVPP-CLFYSBASSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC nameethyl (Z)-3-hydroxy-2-(oxan-4-yl)prop-2-enoate
InChIKeyHNSRSWSQYMAVPP-CLFYSBASSA-N
SMILESCCOC(=O)/C(=C\O)/C1CCOCC1

Computed by PubChem (NCBI)