Products 7283-70-7
CAS 7283-70-7 appears in our catalog under these names: Diisopropyl fumarate, 98%, Diisopropyl Fumarate, Diisopropyl Fumarate, Diisopropyl Fumarate, >98.0%(GC), 2-Butenedioic acid (2E)-, 1,4-bis(1-methylethyl) ester, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, TCI. Available pack sizes: 5g, 25g, 100g, 500g, on request.
Dipropan-2-yl (E)-but-2-enedioate (CAS 7283-70-7) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: dipropan-2-yl (E)-but-2-enedioate. InChIKey: FNMTVMWFISHPEV-AATRIKPKSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | dipropan-2-yl (E)-but-2-enedioate |
| InChIKey | FNMTVMWFISHPEV-AATRIKPKSA-N |
| SMILES | CC(C)OC(=O)/C=C/C(=O)OC(C)C |
Computed by PubChem (NCBI)
Synonyms:
Diisopropyl fumarate, FUMARIC ACID, DIISOPROPYL ESTER, Diisopropylester kyseliny fumarove, 2-Butenedioic acid (2E)-, 1,4-bis(1-methylethyl) ester, 2-Butenedioic acid (E)-, bis(1-methylethyl) ester, Diisopropylester kyseliny fumarove [Czech], 4-02-00-02209 (Beilstein Handbook Reference), 2-Butenedioic acid (E)-, bis(1-methylethyl) ester (9CI), 2-Butenedioic acid, bis(1-methylethyl) ester, (E)-, FNMTVMWFISHPEV-AATRIKPKSA-N