CAS 4355-11-7 appears in our catalog under these names: 1,1-Cyclohexanediacetic acid, 98%, Gabapentin Impurity 2, 1,1-Cyclohexanediacetic Acid, >95% (HPLC), 1,1-Cyclohexanediacetic acid, 98% , 1,1-Cyclohexanediacetic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, Chemat Brand, TRC, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 100g, 1kg, 25g, 5g, 500g, on request, 10g, 50g.
2-[1-(carboxymethyl)cyclohexyl]acetic acid (CAS 4355-11-7) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 2-[1-(carboxymethyl)cyclohexyl]acetic acid. InChIKey: YQPCHPBGAALCRT-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2-[1-(carboxymethyl)cyclohexyl]acetic acid |
| InChIKey | YQPCHPBGAALCRT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)