Products 36326-38-2

CAS 36326-38-2 is the registry number for (E)-3-(2,2-Dimethyl-[1,3]dioxolan-4-yl)-acrylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate (CAS 36326-38-2) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate. InChIKey: GZVXALXOWVXZLH-GJIOHYHPSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC nameethyl (E)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate
InChIKeyGZVXALXOWVXZLH-GJIOHYHPSA-N
SMILESCCOC(=O)/C=C/[C@H]1COC(O1)(C)C

Computed by PubChem (NCBI)