Products 2173108-25-1
CAS 2173108-25-1 appears in our catalog under these names: 2-[(tert-Butoxy)carbonyl]-3-methylbut-2-enoic acid, 98%, 2-((tert-Butoxy)carbonyl)-3-methylbut-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]but-2-enoic acid (CAS 2173108-25-1) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]but-2-enoic acid. InChIKey: FYONFFLSWYSZLH-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]but-2-enoic acid |
| InChIKey | FYONFFLSWYSZLH-UHFFFAOYSA-N |
| SMILES | CC(=C(C(=O)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)