Products 54379-17-8

CAS 54379-17-8 appears in our catalog under these names: 1,1-Cyclohexanedicarboxylic acid 1-ethyl ester, 96%, 1,1-Cyclohexanedicarboxylic acid 1-ethyl ester, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-ethoxycarbonylcyclohexane-1-carboxylic acid (CAS 54379-17-8) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 1-ethoxycarbonylcyclohexane-1-carboxylic acid. InChIKey: KXODEDIOXQDDRS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC name1-ethoxycarbonylcyclohexane-1-carboxylic acid
InChIKeyKXODEDIOXQDDRS-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCCC1)C(=O)O

Computed by PubChem (NCBI)