cas: 1203579-50-3 — see every product listed under this CAS number, including other names
1,2,3,4-Tetrahydroisoquinoline-5-carboxylic acid hydrochloride, 98%, 98% (CAS 1203579-50-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TNR-100mg |
| cas | 1203579-50-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 678.80 Pln | |
| Chemat | 1g | 1293.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2,3,4-tetrahydroisoquinoline-5-carboxylic acid;hydrochloride (CAS 1203579-50-3) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-5-carboxylic acid;hydrochloride. InChIKey: BTYXEABVNVYNIN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-5-carboxylic acid;hydrochloride |
| InChIKey | BTYXEABVNVYNIN-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)