CAS 41994-51-8 appears in our catalog under these names: 1,2,3,4-Tetrahydro-3-isoquinolinecarboxylic acid hydrochloride, 95%, 1,2,3,4–Tetrahydro–3–isoquinolinecarboxylic acid hydrochloride, 1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride 98%, 1,2,3,4-TETRAHYDRO-3-ISOQUINOLINECARBOX&, 1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 10g, 5g, 1g, 50g, 25g, 250mg.
1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride (CAS 41994-51-8) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride. InChIKey: FXHCFPUEIDRTMR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | FXHCFPUEIDRTMR-UHFFFAOYSA-N |
| SMILES | C1C(NCC2=CC=CC=C21)C(=O)O.Cl |
Computed by PubChem (NCBI)