1,2-Bis(3,4-dimethoxyphenyl)ethane-1,2-dione, 98%
cas: 554-34-7 — see every product listed under this CAS number, including other names
1,2-Bis(3,4-dimethoxyphenyl)ethane-1,2-dione, 98% (CAS 554-34-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1693066-100mg |
| cas | 554-34-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 971.12 Pln | |
| Ambeed | 250mg | 1677.56 Pln | |
| Ambeed | 1g | 4169.56 Pln | |
| Ambeed | 5g | 16473.81 Pln | |
| BLDpharm | 100mg | 953.02 Pln | |
| BLDpharm | 250mg | 1647.22 Pln | |
| BLDpharm | 1g | 4090.81 Pln | |
| BLDpharm | 5g | 16158.78 Pln | |
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 952.40 Pln | |
| Chemat | 1g | 2459.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-dione (CAS 554-34-7) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-dione. InChIKey: GMPWPTYBCCEVKH-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-dione |
| InChIKey | GMPWPTYBCCEVKH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)C(=O)C2=CC(=C(C=C2)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Veratril, 1,2-Bis-(3,4-dimethoxy-phenyl)-ethan-1,2-dion, 1,2-Bis-(3,4-dimethoxy-phenyl)-ethan-1,2-dione, GMPWPTYBCCEVKH-UHFFFAOYSA-N, 1,2-bis(3,4-dimethoxyphenyl)ethane-1,2-dione, Ethanedione, bis(3,4-dimethoxyphenyl)-, 1,2-Bis(3,4-dimethoxyphenyl)-1,2-ethanedione #, 1,2-Ethanedione, 1,2-bis(3,4-dimethoxyphenyl)-