1,2-Bis(3-fluorophenoxy)ethane, 97%
cas: 143915-19-9 — see every product listed under this CAS number, including other names
1,2-Bis(3-fluorophenoxy)ethane, 97% (CAS 143915-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F865123-250MG |
| cas | 143915-19-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 404.04 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 147.75 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1235.60 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
1-fluoro-3-[2-(3-fluorophenoxy)ethoxy]benzene (CAS 143915-19-9) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: 1-fluoro-3-[2-(3-fluorophenoxy)ethoxy]benzene. InChIKey: NPEQSLPQCREMMK-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | 1-fluoro-3-[2-(3-fluorophenoxy)ethoxy]benzene |
| InChIKey | NPEQSLPQCREMMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OCCOC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)