Products 1456136-23-4
CAS 1456136-23-4 appears in our catalog under these names: {3-((2,4-difluorophenyl)methoxy)phenyl}methanol, 95%, {3-((2,4-Difluorophenyl)methoxy)phenyl}methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
[3-[(2,4-difluorophenyl)methoxy]phenyl]methanol (CAS 1456136-23-4) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: [3-[(2,4-difluorophenyl)methoxy]phenyl]methanol. InChIKey: LPKXSIVJQUZIAN-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | [3-[(2,4-difluorophenyl)methoxy]phenyl]methanol |
| InChIKey | LPKXSIVJQUZIAN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC2=C(C=C(C=C2)F)F)CO |
Computed by PubChem (NCBI)