CAS 41860-57-5 appears in our catalog under these names: 3,3'-Difluoro-4,4'-dimethoxy-1,1'-biphenyl, 98%, 3,3'-Difluoro-4,4'-dimethoxy-1,1'-biphenyl, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
2-fluoro-4-(3-fluoro-4-methoxyphenyl)-1-methoxybenzene (CAS 41860-57-5) is a chemical compound with the molecular formula C14H12F2O2 and a molecular weight of 250.24 g/mol. IUPAC name: 2-fluoro-4-(3-fluoro-4-methoxyphenyl)-1-methoxybenzene. InChIKey: UNUKTXFJTKSLGB-UHFFFAOYSA-N.
| Molecular formula | C14H12F2O2 |
|---|---|
| Molecular weight | 250.24 g/mol |
| IUPAC name | 2-fluoro-4-(3-fluoro-4-methoxyphenyl)-1-methoxybenzene |
| InChIKey | UNUKTXFJTKSLGB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=C(C=C2)OC)F)F |
Computed by PubChem (NCBI)