CAS 63192-57-4 appears in our catalog under these names: Formoterol Impurity 37, 1,2-Bis(3-hydroxyphenyl)ethane-1,2-dione, 97%, 97%, 1,2-Bis(3-hydroxyphenyl)ethane-1,2-dione, 97%. Offered by: Chemat Brand, Chemat, Ambeed. Available pack sizes: on request, 1g, 5g, 10g, 25g, 100g.
1,2-bis(3-hydroxyphenyl)ethane-1,2-dione (CAS 63192-57-4) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 1,2-bis(3-hydroxyphenyl)ethane-1,2-dione. InChIKey: NRVBEDFRJZDULS-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1,2-bis(3-hydroxyphenyl)ethane-1,2-dione |
| InChIKey | NRVBEDFRJZDULS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(=O)C(=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)