cas: 66126-16-7 — see every product listed under this CAS number, including other names
1,2-Bis(bromomethyl)-3-nitrobenzene 98% (CAS 66126-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A645573-250mg |
| cas | 66126-16-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 10g | 3518.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A645573 |
1,2-bis(bromomethyl)-3-nitrobenzene (CAS 66126-16-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 1,2-bis(bromomethyl)-3-nitrobenzene. InChIKey: IQGHMTSQJHRRFH-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)-3-nitrobenzene |
| InChIKey | IQGHMTSQJHRRFH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)[N+](=O)[O-])CBr)CBr |
Computed by PubChem (NCBI)