CAS 1214375-76-4 appears in our catalog under these names: Ethyl 3,5-dibromoisonicotinate, 95%, Ethyl 3,5-dibromoisonicotinate, 98%, 98%, Ethyl 3,5-dibromoisonicotinate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg.
Ethyl 3,5-dibromopyridine-4-carboxylate (CAS 1214375-76-4) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 3,5-dibromopyridine-4-carboxylate. InChIKey: KWKKIQCPLDQVFV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 3,5-dibromopyridine-4-carboxylate |
| InChIKey | KWKKIQCPLDQVFV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=NC=C1Br)Br |
Computed by PubChem (NCBI)