CAS 6425-66-7 appears in our catalog under these names: 1,2-Bis(bromomethyl)-4-nitrobenzene, 97%, 1,2–Bis(bromomethyl)–4–nitrobenzene, 1,2-Bis(bromomethyl)-4-nitrobenzene 98%, 1,2-Bis(bromomethyl)-4-nitrobenzene, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
1,2-bis(bromomethyl)-4-nitrobenzene (CAS 6425-66-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 1,2-bis(bromomethyl)-4-nitrobenzene. InChIKey: MZEFZKJSWNPTPL-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)-4-nitrobenzene |
| InChIKey | MZEFZKJSWNPTPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CBr)CBr |
Computed by PubChem (NCBI)