CAS 924649-13-8 appears in our catalog under these names: 3,5-Dibromo-4-(1,3-dioxolan-2-yl)pyridine, 97%, 3,5-Dibromo-4-(1,3-dioxolan-2-yl)pyridine, 95%, 3,5-Dibromo-4-(1,3-dioxolan-2-yl)pyridine, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 100g, 1g, 5g.
3,5-dibromo-4-(1,3-dioxolan-2-yl)pyridine (CAS 924649-13-8) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 3,5-dibromo-4-(1,3-dioxolan-2-yl)pyridine. InChIKey: GYEVGSDSVVWFRL-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 3,5-dibromo-4-(1,3-dioxolan-2-yl)pyridine |
| InChIKey | GYEVGSDSVVWFRL-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=NC=C2Br)Br |
Computed by PubChem (NCBI)