Products 2241588-74-7
CAS 2241588-74-7 is the registry number for 6-Amino-2,4-dibromo-3-methyl-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6-amino-2,4-dibromo-3-methylbenzoic acid (CAS 2241588-74-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 6-amino-2,4-dibromo-3-methylbenzoic acid. InChIKey: BBFQKVWSPXYXFV-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 6-amino-2,4-dibromo-3-methylbenzoic acid |
| InChIKey | BBFQKVWSPXYXFV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Br)C(=O)O)N)Br |
Computed by PubChem (NCBI)