CAS 1214332-54-3 appears in our catalog under these names: Ethyl 2,6-dibromonicotinate, 95%, Ethyl 2,6-dibromonicotinate, 95+%, Ethyl 2,6-dibromonicotinate, ≥95%, ≥95%, Ethyl 2,6-dibromonicotinate. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl 2,6-dibromopyridine-3-carboxylate (CAS 1214332-54-3) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: ethyl 2,6-dibromopyridine-3-carboxylate. InChIKey: SBLOKPIKZLUYQO-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | ethyl 2,6-dibromopyridine-3-carboxylate |
| InChIKey | SBLOKPIKZLUYQO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)Br)Br |
Computed by PubChem (NCBI)