CAS 191869-08-6 is the registry number for (4-Amino-3,5-dibromophenyl)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
2-(4-amino-3,5-dibromophenyl)acetic acid (CAS 191869-08-6) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 2-(4-amino-3,5-dibromophenyl)acetic acid. InChIKey: KIYIWMWVYLKCAZ-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 2-(4-amino-3,5-dibromophenyl)acetic acid |
| InChIKey | KIYIWMWVYLKCAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)N)Br)CC(=O)O |
Computed by PubChem (NCBI)