cas: 6425-66-7 — see every product listed under this CAS number, including other names
1,2-Bis(bromomethyl)-4-nitrobenzene, 98%, 98% (CAS 6425-66-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ECBJ-100mg |
| cas | 6425-66-7 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 1667.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,2-bis(bromomethyl)-4-nitrobenzene (CAS 6425-66-7) is a chemical compound with the molecular formula C8H7Br2NO2 and a molecular weight of 308.95 g/mol. IUPAC name: 1,2-bis(bromomethyl)-4-nitrobenzene. InChIKey: MZEFZKJSWNPTPL-UHFFFAOYSA-N.
| Molecular formula | C8H7Br2NO2 |
|---|---|
| Molecular weight | 308.95 g/mol |
| IUPAC name | 1,2-bis(bromomethyl)-4-nitrobenzene |
| InChIKey | MZEFZKJSWNPTPL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])CBr)CBr |
Computed by PubChem (NCBI)