cas: 807334-25-4 — see every product listed under this CAS number, including other names
1,2-Ethanediol, 1-phenyl-, 2-carbamate, (1S)- (9CI), 95%, 95% (CAS 807334-25-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11403S-100mg |
| cas | 807334-25-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1216.40 Pln | |
| Chemat | 1g | 2723.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(2S)-2-hydroxy-2-phenylethyl] carbamate (CAS 807334-25-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: [(2S)-2-hydroxy-2-phenylethyl] carbamate. InChIKey: OCSOHUROTFFTFO-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | [(2S)-2-hydroxy-2-phenylethyl] carbamate |
| InChIKey | OCSOHUROTFFTFO-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](COC(=O)N)O |
Computed by PubChem (NCBI)