Products 807334-25-4
CAS 807334-25-4 appears in our catalog under these names: (S)-2-Hydroxy-2-phenylethyl carbamate, 95%, 1-Phenyl-2-Carbamate-1,2-Ethanediol, (S)-2-Hydroxy-2-phenylethyl carbamate, 97%, (S)–2–hydroxy–2–phenylethyl carbamate, 1,2-Ethanediol, 1-phenyl-, 2-carbamate, (1S)- (9CI), 95%, 95%. Offered by: Combi-blocks, Chemat Brand, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g, on request, 100mg.
[(2S)-2-hydroxy-2-phenylethyl] carbamate (CAS 807334-25-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: [(2S)-2-hydroxy-2-phenylethyl] carbamate. InChIKey: OCSOHUROTFFTFO-MRVPVSSYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | [(2S)-2-hydroxy-2-phenylethyl] carbamate |
| InChIKey | OCSOHUROTFFTFO-MRVPVSSYSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](COC(=O)N)O |
Computed by PubChem (NCBI)